An difríocht idir athruithe ar: "Aigéad eatánóch"
Content deleted Content added
m robot Adding: bn:অ্যাসিটিক এসিড |
Guliolopez (plé | dréachtaí) Am not supporting these "sub templates" - So just pass the param directly to the main template. |
||
Líne 6: | Líne 6: | ||
| IUPACName = Acetic acid, Ethanoic acid |
| IUPACName = Acetic acid, Ethanoic acid |
||
| OtherNames = Acetyl hydroxide (AcOH), Hydrogen acetate (HAc), Ethylic acid, Methanecarboxylic acid |
| OtherNames = Acetyl hydroxide (AcOH), Hydrogen acetate (HAc), Ethylic acid, Methanecarboxylic acid |
||
| Section1 = {{Chembox Identifiers |
|||
| CASNo = 64-19-7 |
| CASNo = 64-19-7 |
||
| PubChem = 176 |
| PubChem = 176 |
||
| InChI=1/C2H4O2/c1-2(3)4/h1H3,<br/>(H,3,4)/f/h3H |
| InChI=1/C2H4O2/c1-2(3)4/h1H3,<br/>(H,3,4)/f/h3H |
||
}} |
|||
| Section2 = {{Chembox Properties |
|||
| Formula = CH<sub>3</sub>COOH |
| Formula = CH<sub>3</sub>COOH |
||
| MolarMass = 60.05 g/mol |
| MolarMass = 60.05 g/mol |
||
Líne 21: | Líne 18: | ||
| pKa = 4.76 at 25 °C |
| pKa = 4.76 at 25 °C |
||
| Viscosity = 1.22 [[pascal second|mPa·s]] at 25 °C |
| Viscosity = 1.22 [[pascal second|mPa·s]] at 25 °C |
||
}} |
|||
| Section3 = {{Chembox Structure |
|||
| Dipole = 1.74 [[Debye|D]] (gas) |
| Dipole = 1.74 [[Debye|D]] (gas) |
||
}} |
|||
| Section7 = {{Chembox Hazards |
|||
| ExternalMSDS = | [[Acetic acid (data page)#Material Safety Data Sheet|External MSDS]] |
| ExternalMSDS = | [[Acetic acid (data page)#Material Safety Data Sheet|External MSDS]] |
||
| NFPA-H = 2 |
| NFPA-H = 2 |
||
Líne 33: | Líne 26: | ||
| RPhrases = {{R10}}, {{R35}} |
| RPhrases = {{R10}}, {{R35}} |
||
| SPhrases = {{S1/2}}, {{S23}}, {{S26}}, {{S45}} |
| SPhrases = {{S1/2}}, {{S23}}, {{S26}}, {{S45}} |
||
}} |
|||
| Section8 = {{Chembox Related |
|||
| Function = [[carboxylic acid]] |
| Function = [[carboxylic acid]] |
||
| OtherFunctn = [[formic acid]], [[propionic acid]], [[butyric acid]] |
| OtherFunctn = [[formic acid]], [[propionic acid]], [[butyric acid]] |
||
| |
| xOtherCpds = [[acetamide]], [[ethyl acetate]], [[acetyl chloride]], [[acetic anhydride]], [[acetonitrile]], [[acetaldehyde]], [[ethanol]], [[thioacetic acid]], [[acetylcholine]], [[acetylcholinesterase]] |
||
}} |
}} |
||
Is cumasc [[orgánach]] [[ceimic]]each é '''an t-Aigéad Aicéiteach''', ag tabhairt an blas searbh agus boladh géar d'fhínéagar. Is í a [[foirmle|fhoirmle]] cheimiceach ná CH<sub>3</sub>COOH. |
Is cumasc [[orgánach]] [[ceimic]]each é '''an t-Aigéad Aicéiteach''', ag tabhairt an blas searbh agus boladh géar d'fhínéagar. Is í a [[foirmle|fhoirmle]] cheimiceach ná CH<sub>3</sub>COOH. |
Leagan ó 19:08, 8 Eanáir 2009
Teimpléad:Chembox new Is cumasc orgánach ceimiceach é an t-Aigéad Aicéiteach, ag tabhairt an blas searbh agus boladh géar d'fhínéagar. Is í a fhoirmle cheimiceach ná CH3COOH.
Is síol é an t-alt seo. Cuir leis, chun cuidiú leis an Vicipéid. Má tá alt níos forbartha le fáil i dteanga eile, is féidir leat aistriúchán Gaeilge a dhéanamh. |
Teimpléad:Nasc AR Teimpléad:Nasc AR Teimpléad:Nasc AR Teimpléad:Nasc AR Teimpléad:Nasc AR