An difríocht idir athruithe ar: "Aigéad eatánóch"

Ón Vicipéid, an chiclipéid shaor.
Content deleted Content added
Am not supporting these "sub templates" - So just pass the param directly to the main template.
Líne 6: Líne 6:
| IUPACName = Acetic acid, Ethanoic acid
| IUPACName = Acetic acid, Ethanoic acid
| OtherNames = Acetyl hydroxide (AcOH), Hydrogen acetate (HAc), Ethylic acid, Methanecarboxylic acid
| OtherNames = Acetyl hydroxide (AcOH), Hydrogen acetate (HAc), Ethylic acid, Methanecarboxylic acid
| Section1 = {{Chembox Identifiers
| CASNo = 64-19-7
| CASNo = 64-19-7
| PubChem = 176
| PubChem = 176
| InChI=1/C2H4O2/c1-2(3)4/h1H3,<br/>(H,3,4)/f/h3H
| InChI=1/C2H4O2/c1-2(3)4/h1H3,<br/>(H,3,4)/f/h3H
}}
| Section2 = {{Chembox Properties
| Formula = CH<sub>3</sub>COOH
| Formula = CH<sub>3</sub>COOH
| MolarMass = 60.05&nbsp;g/mol
| MolarMass = 60.05&nbsp;g/mol
Líne 21: Líne 18:
| pKa = 4.76 at 25&nbsp;°C
| pKa = 4.76 at 25&nbsp;°C
| Viscosity = 1.22&nbsp;[[pascal second|mPa·s]] at 25&nbsp;°C
| Viscosity = 1.22&nbsp;[[pascal second|mPa·s]] at 25&nbsp;°C
}}
| Section3 = {{Chembox Structure
| Dipole = 1.74&nbsp;[[Debye|D]] (gas)
| Dipole = 1.74&nbsp;[[Debye|D]] (gas)
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS = | [[Acetic acid (data page)#Material Safety Data Sheet|External MSDS]]
| ExternalMSDS = | [[Acetic acid (data page)#Material Safety Data Sheet|External MSDS]]
| NFPA-H = 2
| NFPA-H = 2
Líne 33: Líne 26:
| RPhrases = {{R10}}, {{R35}}
| RPhrases = {{R10}}, {{R35}}
| SPhrases = {{S1/2}}, {{S23}}, {{S26}}, {{S45}}
| SPhrases = {{S1/2}}, {{S23}}, {{S26}}, {{S45}}
}}
| Section8 = {{Chembox Related
| Function = [[carboxylic acid]]
| Function = [[carboxylic acid]]
| OtherFunctn = [[formic acid]], [[propionic acid]], [[butyric acid]]
| OtherFunctn = [[formic acid]], [[propionic acid]], [[butyric acid]]
| OtherCpds = [[acetamide]], [[ethyl acetate]], [[acetyl chloride]], [[acetic anhydride]], [[acetonitrile]], [[acetaldehyde]], [[ethanol]], [[thioacetic acid]], [[acetylcholine]], [[acetylcholinesterase]]}}
| xOtherCpds = [[acetamide]], [[ethyl acetate]], [[acetyl chloride]], [[acetic anhydride]], [[acetonitrile]], [[acetaldehyde]], [[ethanol]], [[thioacetic acid]], [[acetylcholine]], [[acetylcholinesterase]]
}}
}}
Is cumasc [[orgánach]] [[ceimic]]each é '''an t-Aigéad Aicéiteach''', ag tabhairt an blas searbh agus boladh géar d'fhínéagar. Is í a [[foirmle|fhoirmle]] cheimiceach ná CH<sub>3</sub>COOH.
Is cumasc [[orgánach]] [[ceimic]]each é '''an t-Aigéad Aicéiteach''', ag tabhairt an blas searbh agus boladh géar d'fhínéagar. Is í a [[foirmle|fhoirmle]] cheimiceach ná CH<sub>3</sub>COOH.

Leagan ó 19:08, 8 Eanáir 2009

Teimpléad:Chembox new Is cumasc orgánach ceimiceach é an t-Aigéad Aicéiteach, ag tabhairt an blas searbh agus boladh géar d'fhínéagar. Is í a fhoirmle cheimiceach ná CH3COOH.

Teimpléad:Nasc AR Teimpléad:Nasc AR Teimpléad:Nasc AR Teimpléad:Nasc AR Teimpléad:Nasc AR